C19H21ClN2O2 — CID 3349109
1-[(3-chlorophenyl)-(5-ethyl-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3349109) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(5-ethyl-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-(5-ethyl-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3349109 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[(3-chlorophenyl)-(5-ethyl-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCc1ccc(C(c2cccc(Cl)c2)N2CCCC2C(=O)O)nc1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-2-13-8-9-16(21-12-13)18(14-5-3-6-15(20)11-14)22-10-4-7-17(22)19(23)24/h3,5-6,8-9,11-12,17-18H,2,4,7,10H2,1H3,(H,23,24) |
| InChIKey | NULQQHKYFHPHQK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |