C19H18ClF3N2O2 — CID 4009744
1-[[4-chloro-3-(trifluoromethyl)phenyl]-pyridin-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4009744) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is 1-[[4-chloro-3-(trifluoromethyl)phenyl]-pyridin-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]-pyridin-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4009744 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]-pyridin-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cccnc1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18ClF3N2O2/c20-15-7-6-12(10-14(15)19(21,22)23)17(13-4-3-8-24-11-13)25-9-2-1-5-16(25)18(26)27/h3-4,6-8,10-11,16-17H,1-2,5,9H2,(H,26,27) |
| InChIKey | RQMFNNUDDDBZAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |