C22H22N2O2 — CID 4540574
1-[isoquinolin-6-yl-(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 4540574) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[isoquinolin-6-yl-(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[isoquinolin-6-yl-(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4540574 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[isoquinolin-6-yl-(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc(C(c2ccc3cnccc3c2)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-15-4-2-5-17(12-15)21(24-11-3-6-20(24)22(25)26)18-7-8-19-14-23-10-9-16(19)13-18/h2,4-5,7-10,12-14,20-21H,3,6,11H2,1H3,(H,25,26) |
| InChIKey | QDNVOPJXBJSYOT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |