C22H27NO2 — CID 4307687
1-[(4-ethylphenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4307687) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-ethylphenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4307687 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[(4-ethylphenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCc1ccc(C(c2cccc(C)c2)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-3-17-10-12-18(13-11-17)21(19-8-6-7-16(2)15-19)23-14-5-4-9-20(23)22(24)25/h6-8,10-13,15,20-21H,3-5,9,14H2,1-2H3,(H,24,25) |
| InChIKey | QKCAFUFQLGOUHZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |