C27H29NO2 — CID 4557631
1-[(4-ethylphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4557631) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-ethylphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4557631 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[(4-ethylphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCc1ccc(C(c2ccc(-c3ccccc3)cc2)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C27H29NO2/c1-2-20-11-13-23(14-12-20)26(28-19-7-6-10-25(28)27(29)30)24-17-15-22(16-18-24)21-8-4-3-5-9-21/h3-5,8-9,11-18,25-26H,2,6-7,10,19H2,1H3,(H,29,30) |
| InChIKey | SUEQLYLPEAIRIK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |