C23H22BrNO2S — CID 4262493
1-[(5-bromothiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4262493) has the molecular formula C23H22BrNO2S and a molecular weight of 456.41 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4262493 |
| Molecular Formula | C23H22BrNO2S |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(-c2ccccc2)cc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C23H22BrNO2S/c24-21-14-13-20(28-21)22(25-15-5-4-8-19(25)23(26)27)18-11-9-17(10-12-18)16-6-2-1-3-7-16/h1-3,6-7,9-14,19,22H,4-5,8,15H2,(H,26,27) |
| InChIKey | NHFUMSQUNLHJRB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |