C17H17BrFNO2S — CID 5177202
1-[(5-bromothiophen-2-yl)-(2-fluorophenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5177202) has the molecular formula C17H17BrFNO2S and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(2-fluorophenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(2-fluorophenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5177202 |
| Molecular Formula | C17H17BrFNO2S |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(2-fluorophenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(Br)s1)c1ccccc1F |
| InChI | InChI=1S/C17H17BrFNO2S/c18-15-9-8-14(23-15)16(11-5-1-2-6-12(11)19)20-10-4-3-7-13(20)17(21)22/h1-2,5-6,8-9,13,16H,3-4,7,10H2,(H,21,22) |
| InChIKey | NKJOBYDPDNEKPB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |