C16H15Cl2NO2S — CID 5107059
1-[(2-chlorophenyl)-(5-chlorothiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 5107059) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-(5-chlorothiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2-chlorophenyl)-(5-chlorothiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5107059 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 1-[(2-chlorophenyl)-(5-chlorothiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccc(Cl)s1)c1ccccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO2S/c17-11-5-2-1-4-10(11)15(13-7-8-14(18)22-13)19-9-3-6-12(19)16(20)21/h1-2,4-5,7-8,12,15H,3,6,9H2,(H,20,21) |
| InChIKey | SOCAZAVVRSATIL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |