C15H16ClNO2S2 — CID 5179677
1-[(5-chlorothiophen-2-yl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 5179677) has the molecular formula C15H16ClNO2S2 and a molecular weight of 341.89 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5179677 |
| Molecular Formula | C15H16ClNO2S2 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccsc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClNO2S2/c16-13-5-4-12(21-13)14(10-6-8-20-9-10)17-7-2-1-3-11(17)15(18)19/h4-6,8-9,11,14H,1-3,7H2,(H,18,19) |
| InChIKey | AYBWQQFCQDVDCX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |