C17H18BrNO2S — CID 4033647
1-[(3-bromophenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4033647) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-bromophenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4033647 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 1-[(3-bromophenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccsc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrNO2S/c18-14-5-3-4-12(10-14)16(13-7-9-22-11-13)19-8-2-1-6-15(19)17(20)21/h3-5,7,9-11,15-16H,1-2,6,8H2,(H,20,21) |
| InChIKey | JIPPQJRCTYSDEN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |