C18H17ClF3NO2S — CID 4015272
1-[[2-chloro-5-(trifluoromethyl)phenyl]-thiophen-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4015272) has the molecular formula C18H17ClF3NO2S and a molecular weight of 403.85 g/mol. Its IUPAC name is 1-[[2-chloro-5-(trifluoromethyl)phenyl]-thiophen-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4015272 |
| Molecular Formula | C18H17ClF3NO2S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccsc1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H17ClF3NO2S/c19-14-5-4-12(18(20,21)22)9-13(14)16(11-6-8-26-10-11)23-7-2-1-3-15(23)17(24)25/h4-6,8-10,15-16H,1-3,7H2,(H,24,25) |
| InChIKey | UHCYIWWCABOWCP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |