C21H20BrNO2S — CID 5217121
1-[1-benzothiophen-3-yl-(3-bromophenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5217121) has the molecular formula C21H20BrNO2S and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-[1-benzothiophen-3-yl-(3-bromophenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-3-yl-(3-bromophenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5217121 |
| Molecular Formula | C21H20BrNO2S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 1-[1-benzothiophen-3-yl-(3-bromophenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cccc(Br)c1)c1csc2ccccc12 |
| InChI | InChI=1S/C21H20BrNO2S/c22-15-7-5-6-14(12-15)20(23-11-4-3-9-18(23)21(24)25)17-13-26-19-10-2-1-8-16(17)19/h1-2,5-8,10,12-13,18,20H,3-4,9,11H2,(H,24,25) |
| InChIKey | JJPANXJYHXNDEC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |