C23H22BrNO2 — CID 4563543
1-[(3-bromophenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4563543) has the molecular formula C23H22BrNO2 and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-bromophenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4563543 |
| Molecular Formula | C23H22BrNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1-[(3-bromophenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cccc(Br)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H22BrNO2/c24-18-10-5-9-17(15-18)22(25-14-4-3-13-21(25)23(26)27)20-12-6-8-16-7-1-2-11-19(16)20/h1-2,5-12,15,21-22H,3-4,13-14H2,(H,26,27) |
| InChIKey | ADOVSBIJRIBKCH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |