C20H22BrNO2 — CID 4645685
1-[(2-bromophenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4645685) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-bromophenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4645685 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-[(2-bromophenyl)-(3-methylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(C(c2ccccc2Br)N2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C20H22BrNO2/c1-14-7-6-8-15(13-14)19(16-9-2-3-10-17(16)21)22-12-5-4-11-18(22)20(23)24/h2-3,6-10,13,18-19H,4-5,11-12H2,1H3,(H,23,24) |
| InChIKey | HNQRHKHEKWLSRG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |