C23H28BrNO4 — CID 4579342
1-[(2-bromophenyl)-(3,4-diethoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4579342) has the molecular formula C23H28BrNO4 and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(3,4-diethoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-bromophenyl)-(3,4-diethoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4579342 |
| Molecular Formula | C23H28BrNO4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[(2-bromophenyl)-(3,4-diethoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccccc2Br)N2CCCCC2C(=O)O)cc1OCC |
| InChI | InChI=1S/C23H28BrNO4/c1-3-28-20-13-12-16(15-21(20)29-4-2)22(17-9-5-6-10-18(17)24)25-14-8-7-11-19(25)23(26)27/h5-6,9-10,12-13,15,19,22H,3-4,7-8,11,14H2,1-2H3,(H,26,27) |
| InChIKey | WGVZAPARXIQTLI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |