C22H26BrNO4 — CID 5031430
1-[(2-bromophenyl)-(3-ethoxy-4-methoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5031430) has the molecular formula C22H26BrNO4 and a molecular weight of 448.36 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(3-ethoxy-4-methoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-bromophenyl)-(3-ethoxy-4-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5031430 |
| Molecular Formula | C22H26BrNO4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 1-[(2-bromophenyl)-(3-ethoxy-4-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1cc(C(c2ccccc2Br)N2CCCCC2C(=O)O)ccc1OC |
| InChI | InChI=1S/C22H26BrNO4/c1-3-28-20-14-15(11-12-19(20)27-2)21(16-8-4-5-9-17(16)23)24-13-7-6-10-18(24)22(25)26/h4-5,8-9,11-12,14,18,21H,3,6-7,10,13H2,1-2H3,(H,25,26) |
| InChIKey | KZRJFUJDYSMFRR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |