C19H19BrFNO3 — CID 4005342
1-[(2-bromophenyl)-(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 4005342) has the molecular formula C19H19BrFNO3 and a molecular weight of 408.27 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2-bromophenyl)-(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4005342 |
| Molecular Formula | C19H19BrFNO3 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 1-[(2-bromophenyl)-(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(c2ccccc2Br)N2CCCC2C(=O)O)cc1F |
| InChI | InChI=1S/C19H19BrFNO3/c1-25-17-9-8-12(11-15(17)21)18(13-5-2-3-6-14(13)20)22-10-4-7-16(22)19(23)24/h2-3,5-6,8-9,11,16,18H,4,7,10H2,1H3,(H,23,24) |
| InChIKey | UXMDZZDUEJXXRO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |