C20H22FNO3 — CID 4202858
1-[(3-fluoro-4-methoxyphenyl)-phenylmethyl]piperidine-2-carboxylic acid (PubChem CID 4202858) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)-phenylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)-phenylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4202858 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)-phenylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(C(c2ccccc2)N2CCCCC2C(=O)O)cc1F |
| InChI | InChI=1S/C20H22FNO3/c1-25-18-11-10-15(13-16(18)21)19(14-7-3-2-4-8-14)22-12-6-5-9-17(22)20(23)24/h2-4,7-8,10-11,13,17,19H,5-6,9,12H2,1H3,(H,23,24) |
| InChIKey | UWHCUASFCSZFES-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |