C21H25NO4 — CID 3313050
1-[(4-ethoxy-3-methoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 3313050) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3313050 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccccc2)N2CCCC2C(=O)O)cc1OC |
| InChI | InChI=1S/C21H25NO4/c1-3-26-18-12-11-16(14-19(18)25-2)20(15-8-5-4-6-9-15)22-13-7-10-17(22)21(23)24/h4-6,8-9,11-12,14,17,20H,3,7,10,13H2,1-2H3,(H,23,24) |
| InChIKey | KTIVJENRILBLRN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |