C22H26ClNO4 — CID 5108088
1-[(3-chlorophenyl)-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5108088) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5108088 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[(3-chlorophenyl)-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2cccc(Cl)c2)N2CCCCC2C(=O)O)cc1OC |
| InChI | InChI=1S/C22H26ClNO4/c1-3-28-19-11-10-16(14-20(19)27-2)21(15-7-6-8-17(23)13-15)24-12-5-4-9-18(24)22(25)26/h6-8,10-11,13-14,18,21H,3-5,9,12H2,1-2H3,(H,25,26) |
| InChIKey | DMKRRRYRJAKKMP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |