C22H27NO4 — CID 4029513
1-[(3,4-diethoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 4029513) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3,4-diethoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4029513 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)-phenylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccccc2)N2CCCC2C(=O)O)cc1OCC |
| InChI | InChI=1S/C22H27NO4/c1-3-26-19-13-12-17(15-20(19)27-4-2)21(16-9-6-5-7-10-16)23-14-8-11-18(23)22(24)25/h5-7,9-10,12-13,15,18,21H,3-4,8,11,14H2,1-2H3,(H,24,25) |
| InChIKey | JMWXEPFESNDVPD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |