C24H25NO2S — CID 3991262
1-[(4-methylsulfanylphenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 3991262) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-methylsulfanylphenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3991262 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)-naphthalen-1-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | CSc1ccc(C(c2cccc3ccccc23)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C24H25NO2S/c1-28-19-14-12-18(13-15-19)23(25-16-5-4-11-22(25)24(26)27)21-10-6-8-17-7-2-3-9-20(17)21/h2-3,6-10,12-15,22-23H,4-5,11,16H2,1H3,(H,26,27) |
| InChIKey | AQCIEWXYCKVZTB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |