C15H16N2O2S — CID 5033531
1-[pyridin-2-yl(thiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 5033531) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[pyridin-2-yl(thiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[pyridin-2-yl(thiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5033531 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[pyridin-2-yl(thiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccsc1)c1ccccn1 |
| InChI | InChI=1S/C15H16N2O2S/c18-15(19)13-5-3-8-17(13)14(11-6-9-20-10-11)12-4-1-2-7-16-12/h1-2,4,6-7,9-10,13-14H,3,5,8H2,(H,18,19) |
| InChIKey | XHWDLFKSTKSQKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |