C23H23NO3S — CID 5115261
1-[(4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 5115261) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[(4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5115261 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[(4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccc(OCc2ccccc2)cc1)c1ccsc1 |
| InChI | InChI=1S/C23H23NO3S/c25-23(26)21-7-4-13-24(21)22(19-12-14-28-16-19)18-8-10-20(11-9-18)27-15-17-5-2-1-3-6-17/h1-3,5-6,8-12,14,16,21-22H,4,7,13,15H2,(H,25,26) |
| InChIKey | SHPMKYXJOWRUGN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |