C24H25NO3S — CID 3681546
1-[(5-methylthiophen-2-yl)-(4-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3681546) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-[(5-methylthiophen-2-yl)-(4-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(5-methylthiophen-2-yl)-(4-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3681546 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[(5-methylthiophen-2-yl)-(4-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(c2ccc(OCc3ccccc3)cc2)N2CCCC2C(=O)O)s1 |
| InChI | InChI=1S/C24H25NO3S/c1-17-9-14-22(29-17)23(25-15-5-8-21(25)24(26)27)19-10-12-20(13-11-19)28-16-18-6-3-2-4-7-18/h2-4,6-7,9-14,21,23H,5,8,15-16H2,1H3,(H,26,27) |
| InChIKey | QBEIOBYZOAYBPZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |