C18H21NO3S — CID 3894359
1-[(4-methoxyphenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 3894359) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3894359 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[(4-methoxyphenyl)-thiophen-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(C(c2ccsc2)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C18H21NO3S/c1-22-15-7-5-13(6-8-15)17(14-9-11-23-12-14)19-10-3-2-4-16(19)18(20)21/h5-9,11-12,16-17H,2-4,10H2,1H3,(H,20,21) |
| InChIKey | VZNXKAZELVKNDL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |