C19H23NO3S — CID 3946231
1-[(4-methoxyphenyl)-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 3946231) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3946231 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(C(c2sccc2C)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-13-10-12-24-18(13)17(14-6-8-15(23-2)9-7-14)20-11-4-3-5-16(20)19(21)22/h6-10,12,16-17H,3-5,11H2,1-2H3,(H,21,22) |
| InChIKey | OOMYGOZKHAFQSZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |