C20H26N2O2S — CID 3923945
1-[[4-(dimethylamino)phenyl]-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 3923945) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3923945 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-(3-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1ccsc1C(c1ccc(N(C)C)cc1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C20H26N2O2S/c1-14-11-13-25-19(14)18(15-7-9-16(10-8-15)21(2)3)22-12-5-4-6-17(22)20(23)24/h7-11,13,17-18H,4-6,12H2,1-3H3,(H,23,24) |
| InChIKey | SDKKBUAKQDSHAI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|