C27H30N2O3 — CID 4579334
1-[[4-(dimethylamino)phenyl]-(3-phenoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4579334) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-(3-phenoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-(3-phenoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4579334 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-(3-phenoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CN(C)c1ccc(C(c2cccc(Oc3ccccc3)c2)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-28(2)22-16-14-20(15-17-22)26(29-18-7-6-13-25(29)27(30)31)21-9-8-12-24(19-21)32-23-10-4-3-5-11-23/h3-5,8-12,14-17,19,25-26H,6-7,13,18H2,1-2H3,(H,30,31) |
| InChIKey | KUWJTLNSGRUNES-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|