C22H26N2O4 — CID 3488145
1-[1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 3488145) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3488145 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | CN(C)c1ccc(C(c2ccc3c(c2)OCO3)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-23(2)17-9-6-15(7-10-17)21(24-12-4-3-5-18(24)22(25)26)16-8-11-19-20(13-16)28-14-27-19/h6-11,13,18,21H,3-5,12,14H2,1-2H3,(H,25,26) |
| InChIKey | FSGGCMSNUVNXGF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|