C27H29NO3 — CID 4291092
1-[(3-ethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4291092) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[(3-ethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-ethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4291092 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[(3-ethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1cccc(C(c2ccc(-c3ccccc3)cc2)N2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C27H29NO3/c1-2-31-24-12-8-11-23(19-24)26(28-18-7-6-13-25(28)27(29)30)22-16-14-21(15-17-22)20-9-4-3-5-10-20/h3-5,8-12,14-17,19,25-26H,2,6-7,13,18H2,1H3,(H,29,30) |
| InChIKey | NJQGAQWESJOOFB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |