C18H22N2O2S — CID 5091825
1-[[4-(dimethylamino)phenyl]-thiophen-2-ylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 5091825) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-thiophen-2-ylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-thiophen-2-ylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5091825 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-thiophen-2-ylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN(C)c1ccc(C(c2cccs2)N2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-19(2)14-9-7-13(8-10-14)17(16-6-4-12-23-16)20-11-3-5-15(20)18(21)22/h4,6-10,12,15,17H,3,5,11H2,1-2H3,(H,21,22) |
| InChIKey | KEHXAXXENMFSKH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|