C22H27ClN2O3 — CID 4241257
1-[(5-chloro-2-methoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 4241257) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4241257 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1ccc(N(C)C)cc1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C22H27ClN2O3/c1-24(2)17-10-7-15(8-11-17)21(18-14-16(23)9-12-20(18)28-3)25-13-5-4-6-19(25)22(26)27/h7-12,14,19,21H,4-6,13H2,1-3H3,(H,26,27) |
| InChIKey | AAOOOWLQKKDLMB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|