C24H24ClNO3 — CID 5129881
1-[(5-chloro-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 5129881) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5129881 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1ccc2ccccc2c1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C24H24ClNO3/c1-29-22-12-11-19(25)15-20(22)23(26-13-5-4-8-21(26)24(27)28)18-10-9-16-6-2-3-7-17(16)14-18/h2-3,6-7,9-12,14-15,21,23H,4-5,8,13H2,1H3,(H,27,28) |
| InChIKey | QMWBFJNLMLQVGL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |