C25H27NO4 — CID 5040339
1-[(2,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 5040339) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5040339 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(OC)c(C(c2ccc3ccccc3c2)N2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C25H27NO4/c1-29-20-12-13-23(30-2)21(16-20)24(26-14-6-5-9-22(26)25(27)28)19-11-10-17-7-3-4-8-18(17)15-19/h3-4,7-8,10-13,15-16,22,24H,5-6,9,14H2,1-2H3,(H,27,28) |
| InChIKey | NTYGJQFTLVGNEQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |