C24H26N2O4 — CID 5004191
1-[(2,5-dimethoxyphenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 5004191) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2,5-dimethoxyphenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5004191 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(OC)c(C(c2cnc3ccccc3c2)N2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-29-18-10-11-22(30-2)19(14-18)23(26-12-6-5-9-21(26)24(27)28)17-13-16-7-3-4-8-20(16)25-15-17/h3-4,7-8,10-11,13-15,21,23H,5-6,9,12H2,1-2H3,(H,27,28) |
| InChIKey | ANXDZZAUONZGLD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |