C25H28N2O5 — CID 3309289
1-[quinolin-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 3309289) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[quinolin-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[quinolin-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3309289 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-[quinolin-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | COc1cc(C(c2cnc3ccccc3c2)N2CCCCC2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N2O5/c1-30-21-13-17(14-22(31-2)24(21)32-3)23(27-11-7-6-10-20(27)25(28)29)18-12-16-8-4-5-9-19(16)26-15-18/h4-5,8-9,12-15,20,23H,6-7,10-11H2,1-3H3,(H,28,29) |
| InChIKey | FDBSMTOXLKIFSC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |