C17H19NO2S — CID 3986635
1-[(3-methylphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 3986635) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-[(3-methylphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-methylphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3986635 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-[(3-methylphenyl)-thiophen-3-ylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc(C(c2ccsc2)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C17H19NO2S/c1-12-4-2-5-13(10-12)16(14-7-9-21-11-14)18-8-3-6-15(18)17(19)20/h2,4-5,7,9-11,15-16H,3,6,8H2,1H3,(H,19,20) |
| InChIKey | YHVYPVNFXDCLRM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |