C24H24N2O2 — CID 4589544
1-[(4-phenylphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4589544) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(4-phenylphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-phenylphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4589544 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[(4-phenylphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(-c2ccccc2)cc1)c1ccccn1 |
| InChI | InChI=1S/C24H24N2O2/c27-24(28)22-11-5-7-17-26(22)23(21-10-4-6-16-25-21)20-14-12-19(13-15-20)18-8-2-1-3-9-18/h1-4,6,8-10,12-16,22-23H,5,7,11,17H2,(H,27,28) |
| InChIKey | FBTUVXAEHIOJQF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |