C25H26N2O2 — CID 3568909
1-[(6-methyl-2-pyridinyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 3568909) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[(6-methyl-2-pyridinyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(6-methyl-2-pyridinyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3568909 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[(6-methyl-2-pyridinyl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(C(c2ccc(-c3ccccc3)cc2)N2CCCCC2C(=O)O)n1 |
| InChI | InChI=1S/C25H26N2O2/c1-18-8-7-11-22(26-18)24(27-17-6-5-12-23(27)25(28)29)21-15-13-20(14-16-21)19-9-3-2-4-10-19/h2-4,7-11,13-16,23-24H,5-6,12,17H2,1H3,(H,28,29) |
| InChIKey | VTBYAPGCEWQCGV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |