C20H18BrNO2S — CID 5211715
1-[(5-bromothiophen-2-yl)-naphthalen-1-ylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 5211715) has the molecular formula C20H18BrNO2S and a molecular weight of 416.34 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-naphthalen-1-ylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-naphthalen-1-ylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5211715 |
| Molecular Formula | C20H18BrNO2S |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-naphthalen-1-ylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccc(Br)s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18BrNO2S/c21-18-11-10-17(25-18)19(22-12-4-9-16(22)20(23)24)15-8-3-6-13-5-1-2-7-14(13)15/h1-3,5-8,10-11,16,19H,4,9,12H2,(H,23,24) |
| InChIKey | WLRSZHLPDAIRDP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |