C24H24BrNO3S — CID 4024194
1-[(5-bromothiophen-2-yl)-(2-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4024194) has the molecular formula C24H24BrNO3S and a molecular weight of 486.43 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(2-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(2-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4024194 |
| Molecular Formula | C24H24BrNO3S |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(2-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(Br)s1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24BrNO3S/c25-22-14-13-21(30-22)23(26-15-7-6-11-19(26)24(27)28)18-10-4-5-12-20(18)29-16-17-8-2-1-3-9-17/h1-5,8-10,12-14,19,23H,6-7,11,15-16H2,(H,27,28) |
| InChIKey | VMKMONXMOPPPBA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |