C18H20BrNO3S — CID 5130194
1-[(5-bromothiophen-2-yl)-(3-methoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5130194) has the molecular formula C18H20BrNO3S and a molecular weight of 410.33 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(3-methoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(3-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5130194 |
| Molecular Formula | C18H20BrNO3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(3-methoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | COc1cccc(C(c2ccc(Br)s2)N2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C18H20BrNO3S/c1-23-13-6-4-5-12(11-13)17(15-8-9-16(19)24-15)20-10-3-2-7-14(20)18(21)22/h4-6,8-9,11,14,17H,2-3,7,10H2,1H3,(H,21,22) |
| InChIKey | IOVARJOWNPPAQW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |