C25H27NO2S — CID 4023938
1-[(5-ethylthiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 4023938) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-ethylthiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4023938 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)-(4-phenylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCc1ccc(C(c2ccc(-c3ccccc3)cc2)N2CCCCC2C(=O)O)s1 |
| InChI | InChI=1S/C25H27NO2S/c1-2-21-15-16-23(29-21)24(26-17-7-6-10-22(26)25(27)28)20-13-11-19(12-14-20)18-8-4-3-5-9-18/h3-5,8-9,11-16,22,24H,2,6-7,10,17H2,1H3,(H,27,28) |
| InChIKey | JBIUWEXMQMPWFZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |