C20H20F3NO3 — CID 5001366
1-[(4-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 5001366) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5001366 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(c2cccc(C(F)(F)F)c2)N2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-27-16-9-7-13(8-10-16)18(24-11-3-6-17(24)19(25)26)14-4-2-5-15(12-14)20(21,22)23/h2,4-5,7-10,12,17-18H,3,6,11H2,1H3,(H,25,26) |
| InChIKey | ZOPUUUVZJQBDIC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |