C20H21F3N2O2 — CID 4269127
1-[2-pyridin-2-yl-1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-2-carboxylic acid (PubChem CID 4269127) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is 1-[2-pyridin-2-yl-1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-pyridin-2-yl-1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4269127 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[2-pyridin-2-yl-1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(Cc1ccccn1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O2/c21-20(22,23)16-9-2-1-8-15(16)18(13-14-7-3-5-11-24-14)25-12-6-4-10-17(25)19(26)27/h1-3,5,7-9,11,17-18H,4,6,10,12-13H2,(H,26,27) |
| InChIKey | NRCSFYKKMLEEAY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |