About (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol
(2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol (PubChem CID 104521199) has the molecular formula C16H24O3S
and a molecular weight of 296.43 g/mol. Its IUPAC name is (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol.
Molecular Properties
| Compound Name | (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol |
| PubChem CID | 104521199 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol |
| SMILES | CCc1ccc(CC)c(C(O)C2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H24O3S/c1-3-12-8-9-13(4-2)14(11-12)16(17)15-7-5-6-10-20(15,18)19/h8-9,11,15-17H,3-7,10H2,1-2H3 |
| InChIKey | VVAARKHCWLBWHO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol?
The IUPAC name of (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol (CID 104521199) is (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol.
What is the SMILES notation for (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol?
The canonical SMILES for (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol is CCc1ccc(CC)c(C(O)C2CCCCS2(=O)=O)c1.
What is the InChIKey of (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol?
The InChIKey is VVAARKHCWLBWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3S/c1-3-12-8-9-13(4-2)14(11-12)16(17)15-7-5-6-10-20(15,18)19/h8-9,11,15-17H,3-7,10H2,1-2H3.
What are the key properties of (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol?
(2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol has a molecular weight of 296.43 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-diethylphenyl)-(1,1-dioxothian-2-yl)methanol is sourced from PubChem (CID 104521199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).