C11H14F2 — CID 143346890
2-(difluoromethyl)-1,4-diethylbenzene (PubChem CID 143346890) has the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,4-diethylbenzene.
| Compound Name | 2-(difluoromethyl)-1,4-diethylbenzene |
|---|---|
| PubChem CID | 143346890 |
| Molecular Formula | C11H14F2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-(difluoromethyl)-1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)c(C(F)F)c1 |
| InChI | InChI=1S/C11H14F2/c1-3-8-5-6-9(4-2)10(7-8)11(12)13/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | ZKXSVXQXJKZSIO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |