C13H15BrF4 — CID 79659672
2-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,4-diethylbenzene (PubChem CID 79659672) has the molecular formula C13H15BrF4 and a molecular weight of 327.16 g/mol. Its IUPAC name is 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,4-diethylbenzene.
| Compound Name | 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,4-diethylbenzene |
|---|---|
| PubChem CID | 79659672 |
| Molecular Formula | C13H15BrF4 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)c(C(Br)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H15BrF4/c1-3-8-5-6-9(4-2)10(7-8)11(14)13(17,18)12(15)16/h5-7,11-12H,3-4H2,1-2H3 |
| InChIKey | ANDXSQFRXLBVNC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|