C18H29Cl — CID 82987639
2-(1-chloro-2-propylpentyl)-1,4-diethylbenzene (PubChem CID 82987639) has the molecular formula C18H29Cl and a molecular weight of 280.88 g/mol. Its IUPAC name is 2-(1-chloro-2-propylpentyl)-1,4-diethylbenzene.
| Compound Name | 2-(1-chloro-2-propylpentyl)-1,4-diethylbenzene |
|---|---|
| PubChem CID | 82987639 |
| Molecular Formula | C18H29Cl |
| Molecular Weight | 280.88 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-(1-chloro-2-propylpentyl)-1,4-diethylbenzene |
| SMILES | CCCC(CCC)C(Cl)c1cc(CC)ccc1CC |
| InChI | InChI=1S/C18H29Cl/c1-5-9-16(10-6-2)18(19)17-13-14(7-3)11-12-15(17)8-4/h11-13,16,18H,5-10H2,1-4H3 |
| InChIKey | QPOUQQQNMUWCAG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|